About 2,3-dihydroxypentanoic acid
2,3-dihydroxypentanoic acid (PubChem CID 20848966) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is 2,3-dihydroxypentanoic acid.
Molecular Properties
| Compound Name | 2,3-dihydroxypentanoic acid |
| PubChem CID | 20848966 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 2,3-dihydroxypentanoic acid |
| SMILES | CCC(O)C(O)C(=O)O |
| InChI | InChI=1S/C5H10O4/c1-2-3(6)4(7)5(8)9/h3-4,6-7H,2H2,1H3,(H,8,9) |
| InChIKey | CJXCLBPFKGZXJP-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydroxypentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypentanoic acid?
The IUPAC name of 2,3-dihydroxypentanoic acid (CID 20848966) is 2,3-dihydroxypentanoic acid.
What is the SMILES notation for 2,3-dihydroxypentanoic acid?
The canonical SMILES for 2,3-dihydroxypentanoic acid is CCC(O)C(O)C(=O)O.
What is the InChIKey of 2,3-dihydroxypentanoic acid?
The InChIKey is CJXCLBPFKGZXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4/c1-2-3(6)4(7)5(8)9/h3-4,6-7H,2H2,1H3,(H,8,9).
What are the key properties of 2,3-dihydroxypentanoic acid?
2,3-dihydroxypentanoic acid has a molecular weight of 134.13 g/mol, XLogP of -0.80, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypentanoic acid is sourced from PubChem (CID 20848966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).