2,3-dihydroxypentanoic acid

C5H10O4 — CID 20848966

IUPAC2,3-dihydroxypentanoic acid
SMILESCCC(O)C(O)C(=O)O
InChIInChI=1S/C5H10O4/c1-2-3(6)4(7)5(8)9/h3-4,6-7H,2H2,1H3,(H,8,9)
InChIKeyCJXCLBPFKGZXJP-UHFFFAOYSA-N
MW134.13 g/mol
LogP-0.80
Rot. Bonds3

About 2,3-dihydroxypentanoic acid

2,3-dihydroxypentanoic acid (PubChem CID 20848966) has the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. Its IUPAC name is 2,3-dihydroxypentanoic acid.

Molecular Properties

Compound Name2,3-dihydroxypentanoic acid
PubChem CID20848966
Molecular FormulaC5H10O4
Molecular Weight134.13 g/mol
Exact Mass134.06
IUPAC Name2,3-dihydroxypentanoic acid
SMILESCCC(O)C(O)C(=O)O
InChIInChI=1S/C5H10O4/c1-2-3(6)4(7)5(8)9/h3-4,6-7H,2H2,1H3,(H,8,9)
InChIKeyCJXCLBPFKGZXJP-UHFFFAOYSA-N
XLogP-0.80
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.13
LogP ≤ 5-0.80
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,3-dihydroxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxypentanoic acid?
The IUPAC name of 2,3-dihydroxypentanoic acid (CID 20848966) is 2,3-dihydroxypentanoic acid.
What is the SMILES notation for 2,3-dihydroxypentanoic acid?
The canonical SMILES for 2,3-dihydroxypentanoic acid is CCC(O)C(O)C(=O)O.
What is the InChIKey of 2,3-dihydroxypentanoic acid?
The InChIKey is CJXCLBPFKGZXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4/c1-2-3(6)4(7)5(8)9/h3-4,6-7H,2H2,1H3,(H,8,9).
What are the key properties of 2,3-dihydroxypentanoic acid?
2,3-dihydroxypentanoic acid has a molecular weight of 134.13 g/mol, XLogP of -0.80, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypentanoic acid is sourced from PubChem (CID 20848966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).