C6H14O6 — CID 20849066
(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;hydrate (PubChem CID 20849066) has the molecular formula C6H14O6 and a molecular weight of 182.17 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;hydrate.
| Compound Name | (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;hydrate |
|---|---|
| PubChem CID | 20849066 |
| Molecular Formula | C6H14O6 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;hydrate |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O.O |
| InChI | InChI=1S/C6H12O5.H2O/c1-3(8)5(10)6(11)4(9)2-7;/h2-6,8-11H,1H3;1H2/t3-,4-,5-,6-;/m0./s1 |
| InChIKey | CBDCDOTZPYZPRO-DEZHIRTDSA-N |
| XLogP | -3.18 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|