(2R)-3-hydroxy-2-methoxypropanoic acid

C4H8O4 — CID 20849197

IUPAC(2R)-3-hydroxy-2-methoxypropanoic acid
SMILESCO[C@H](CO)C(=O)O
InChIInChI=1S/C4H8O4/c1-8-3(2-5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1
InChIKeyYNLNJDRLOAQMFQ-GSVOUGTGSA-N
MW120.10 g/mol
LogP-0.92
Rot. Bonds3

About (2R)-3-hydroxy-2-methoxypropanoic acid

(2R)-3-hydroxy-2-methoxypropanoic acid (PubChem CID 20849197) has the molecular formula C4H8O4 and a molecular weight of 120.10 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-methoxypropanoic acid.

Molecular Properties

Compound Name(2R)-3-hydroxy-2-methoxypropanoic acid
PubChem CID20849197
Molecular FormulaC4H8O4
Molecular Weight120.10 g/mol
Exact Mass120.04
IUPAC Name(2R)-3-hydroxy-2-methoxypropanoic acid
SMILESCO[C@H](CO)C(=O)O
InChIInChI=1S/C4H8O4/c1-8-3(2-5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1
InChIKeyYNLNJDRLOAQMFQ-GSVOUGTGSA-N
XLogP-0.92
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500120.10
LogP ≤ 5-0.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-3-hydroxy-2-methoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-3-hydroxy-2-methoxypropanoic acid?
The IUPAC name of (2R)-3-hydroxy-2-methoxypropanoic acid (CID 20849197) is (2R)-3-hydroxy-2-methoxypropanoic acid.
What is the SMILES notation for (2R)-3-hydroxy-2-methoxypropanoic acid?
The canonical SMILES for (2R)-3-hydroxy-2-methoxypropanoic acid is CO[C@H](CO)C(=O)O.
What is the InChIKey of (2R)-3-hydroxy-2-methoxypropanoic acid?
The InChIKey is YNLNJDRLOAQMFQ-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H8O4/c1-8-3(2-5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1.
What are the key properties of (2R)-3-hydroxy-2-methoxypropanoic acid?
(2R)-3-hydroxy-2-methoxypropanoic acid has a molecular weight of 120.10 g/mol, XLogP of -0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-hydroxy-2-methoxypropanoic acid is sourced from PubChem (CID 20849197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).