C22H30O7S2 — CID 20849309
2-decyl-3-(2-sulfophenoxy)benzenesulfonic acid (PubChem CID 20849309) has the molecular formula C22H30O7S2 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-decyl-3-(2-sulfophenoxy)benzenesulfonic acid.
| Compound Name | 2-decyl-3-(2-sulfophenoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 20849309 |
| Molecular Formula | C22H30O7S2 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-decyl-3-(2-sulfophenoxy)benzenesulfonic acid |
| SMILES | CCCCCCCCCCc1c(Oc2ccccc2S(=O)(=O)O)cccc1S(=O)(=O)O |
| InChI | InChI=1S/C22H30O7S2/c1-2-3-4-5-6-7-8-9-13-18-19(15-12-17-21(18)30(23,24)25)29-20-14-10-11-16-22(20)31(26,27)28/h10-12,14-17H,2-9,13H2,1H3,(H,23,24,25)(H,26,27,28) |
| InChIKey | WJNPDWHTWLBWJT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|