About bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate
bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate (PubChem CID 20849354) has the molecular formula C8H17N3O4
and a molecular weight of 219.24 g/mol. Its IUPAC name is bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate.
Molecular Properties
| Compound Name | bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate |
| PubChem CID | 20849354 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate |
| SMILES | O=C1C=CC([O-])NN1.OCC[NH2+]CCO |
| InChI | InChI=1S/C4H5N2O2.C4H11NO2/c7-3-1-2-4(8)6-5-3;6-3-1-5-2-4-7/h1-3,5H,(H,6,8);5-7H,1-4H2/q-1;/p+1 |
| InChIKey | JHGNWZKPQXWUIE-UHFFFAOYSA-O |
| XLogP | -4.60 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate?
The IUPAC name of bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate (CID 20849354) is bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate.
What is the SMILES notation for bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate?
The canonical SMILES for bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate is O=C1C=CC([O-])NN1.OCC[NH2+]CCO.
What is the InChIKey of bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate?
The InChIKey is JHGNWZKPQXWUIE-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H5N2O2.C4H11NO2/c7-3-1-2-4(8)6-5-3;6-3-1-5-2-4-7/h1-3,5H,(H,6,8);5-7H,1-4H2/q-1;/p+1.
What are the key properties of bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate?
bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate has a molecular weight of 219.24 g/mol, XLogP of -4.60, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl)azanium;6-oxo-2,3-dihydro-1H-pyridazin-3-olate is sourced from PubChem (CID 20849354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).