C17H19Cl2NO — CID 20849471
1-(5,7-dichloro-2,3,4,4a-tetrahydro-1H-xanthen-4-yl)pyrrolidine (PubChem CID 20849471) has the molecular formula C17H19Cl2NO and a molecular weight of 324.25 g/mol. Its IUPAC name is 1-(5,7-dichloro-2,3,4,4a-tetrahydro-1H-xanthen-4-yl)pyrrolidine.
| Compound Name | 1-(5,7-dichloro-2,3,4,4a-tetrahydro-1H-xanthen-4-yl)pyrrolidine |
|---|---|
| PubChem CID | 20849471 |
| Molecular Formula | C17H19Cl2NO |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-(5,7-dichloro-2,3,4,4a-tetrahydro-1H-xanthen-4-yl)pyrrolidine |
| SMILES | Clc1cc(Cl)c2c(c1)C=C1CCCC(N3CCCC3)C1O2 |
| InChI | InChI=1S/C17H19Cl2NO/c18-13-9-12-8-11-4-3-5-15(20-6-1-2-7-20)17(11)21-16(12)14(19)10-13/h8-10,15,17H,1-7H2 |
| InChIKey | XJSMAYZBXYSGHZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |