C14H16N4O — CID 20850225
N-ethyl-6,7,8,9-tetrahydropyrido[4,3-b][1,6]naphthyridine-9-carboxamide (PubChem CID 20850225) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is N-ethyl-6,7,8,9-tetrahydropyrido[4,3-b][1,6]naphthyridine-9-carboxamide.
| Compound Name | N-ethyl-6,7,8,9-tetrahydropyrido[4,3-b][1,6]naphthyridine-9-carboxamide |
|---|---|
| PubChem CID | 20850225 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-ethyl-6,7,8,9-tetrahydropyrido[4,3-b][1,6]naphthyridine-9-carboxamide |
| SMILES | CCNC(=O)C1NCCc2nc3ccncc3cc21 |
| InChI | InChI=1S/C14H16N4O/c1-2-16-14(19)13-10-7-9-8-15-5-3-11(9)18-12(10)4-6-17-13/h3,5,7-8,13,17H,2,4,6H2,1H3,(H,16,19) |
| InChIKey | SNVDCKLXEXNFNL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |