C15H15ClN2O4S — CID 20850595
1-chloro-3-[[4-[dimethyl(sulfonato)azaniumyl]benzoyl]amino]benzene (PubChem CID 20850595) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is 1-chloro-3-[[4-[dimethyl(sulfonato)azaniumyl]benzoyl]amino]benzene.
| Compound Name | 1-chloro-3-[[4-[dimethyl(sulfonato)azaniumyl]benzoyl]amino]benzene |
|---|---|
| PubChem CID | 20850595 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-chloro-3-[[4-[dimethyl(sulfonato)azaniumyl]benzoyl]amino]benzene |
| SMILES | C[N+](C)(c1ccc(C(=O)Nc2cccc(Cl)c2)cc1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C15H15ClN2O4S/c1-18(2,23(20,21)22)14-8-6-11(7-9-14)15(19)17-13-5-3-4-12(16)10-13/h3-10H,1-2H3,(H-,17,19,20,21,22) |
| InChIKey | ZGTMYTYOTZUYTE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|