About trioctylphosphane
trioctylphosphane (PubChem CID 20851) has the molecular formula C24H51P
and a molecular weight of 370.65 g/mol. Its IUPAC name is trioctylphosphane.
Molecular Properties
| Compound Name | trioctylphosphane |
| PubChem CID | 20851 |
| Molecular Formula | C24H51P |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.37 |
| IUPAC Name | trioctylphosphane |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| InChIKey | RMZAYIKUYWXQPB-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trioctylphosphane?
The IUPAC name of trioctylphosphane (CID 20851) is trioctylphosphane.
What is the SMILES notation for trioctylphosphane?
The canonical SMILES for trioctylphosphane is CCCCCCCCP(CCCCCCCC)CCCCCCCC.
What is the InChIKey of trioctylphosphane?
The InChIKey is RMZAYIKUYWXQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3.
What are the key properties of trioctylphosphane?
trioctylphosphane has a molecular weight of 370.65 g/mol, XLogP of 9.55, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trioctylphosphane is sourced from PubChem (CID 20851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).