C25H18FN3O3 — CID 20852714
14-(4-fluorophenyl)-12-(4-methoxyphenyl)-4,7-dioxa-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,11(15),13,16-hexaene (PubChem CID 20852714) has the molecular formula C25H18FN3O3 and a molecular weight of 427.44 g/mol. Its IUPAC name is 14-(4-fluorophenyl)-12-(4-methoxyphenyl)-4,7-dioxa-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,11(15),13,16-hexaene.
| Compound Name | 14-(4-fluorophenyl)-12-(4-methoxyphenyl)-4,7-dioxa-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,11(15),13,16-hexaene |
|---|---|
| PubChem CID | 20852714 |
| Molecular Formula | C25H18FN3O3 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 14-(4-fluorophenyl)-12-(4-methoxyphenyl)-4,7-dioxa-12,13,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,11(15),13,16-hexaene |
| SMILES | COc1ccc(-n2nc(-c3ccc(F)cc3)c3cnc4cc5c(cc4c32)OCCO5)cc1 |
| InChI | InChI=1S/C25H18FN3O3/c1-30-18-8-6-17(7-9-18)29-25-19-12-22-23(32-11-10-31-22)13-21(19)27-14-20(25)24(28-29)15-2-4-16(26)5-3-15/h2-9,12-14H,10-11H2,1H3 |
| InChIKey | JPSPSWCKGMCQKF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |