About 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline
3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline (PubChem CID 20852872) has the molecular formula C23H15ClFN3
and a molecular weight of 387.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline |
| PubChem CID | 20852872 |
| Molecular Formula | C23H15ClFN3 |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline |
| SMILES | Cc1ccc2ncc3c(-c4ccc(Cl)cc4)nn(-c4ccc(F)cc4)c3c2c1 |
| InChI | InChI=1S/C23H15ClFN3/c1-14-2-11-21-19(12-14)23-20(13-26-21)22(15-3-5-16(24)6-4-15)27-28(23)18-9-7-17(25)8-10-18/h2-13H,1H3 |
| InChIKey | IWNCOVXKUCFEQH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline?
The IUPAC name of 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline (CID 20852872) is 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline.
What is the SMILES notation for 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline?
The canonical SMILES for 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline is Cc1ccc2ncc3c(-c4ccc(Cl)cc4)nn(-c4ccc(F)cc4)c3c2c1.
What is the InChIKey of 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline?
The InChIKey is IWNCOVXKUCFEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15ClFN3/c1-14-2-11-21-19(12-14)23-20(13-26-21)22(15-3-5-16(24)6-4-15)27-28(23)18-9-7-17(25)8-10-18/h2-13H,1H3.
What are the key properties of 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline?
3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline has a molecular weight of 387.85 g/mol, XLogP of 6.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1-(4-fluorophenyl)-8-methylpyrazolo[4,3-c]quinoline is sourced from PubChem (CID 20852872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).