C22H25N3O2S — CID 20853588
4-(3,5-dimethylpiperidine-1-carbonyl)-17-thia-2,8-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-9-one (PubChem CID 20853588) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidine-1-carbonyl)-17-thia-2,8-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-9-one.
| Compound Name | 4-(3,5-dimethylpiperidine-1-carbonyl)-17-thia-2,8-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-9-one |
|---|---|
| PubChem CID | 20853588 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-(3,5-dimethylpiperidine-1-carbonyl)-17-thia-2,8-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-9-one |
| SMILES | CC1CC(C)CN(C(=O)c2cccn3c(=O)c4c5c(sc4nc23)CCCC5)C1 |
| InChI | InChI=1S/C22H25N3O2S/c1-13-10-14(2)12-24(11-13)21(26)16-7-5-9-25-19(16)23-20-18(22(25)27)15-6-3-4-8-17(15)28-20/h5,7,9,13-14H,3-4,6,8,10-12H2,1-2H3 |
| InChIKey | IVOAGGFKFLUPPC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |