About N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide
N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 20854671) has the molecular formula C21H31N3O2
and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
Molecular Properties
| Compound Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| PubChem CID | 20854671 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CC1CCCC(C)N1CCCNC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H31N3O2/c1-16-6-3-7-17(2)23(16)15-5-13-22-21(26)18-9-11-19(12-10-18)24-14-4-8-20(24)25/h9-12,16-17H,3-8,13-15H2,1-2H3,(H,22,26) |
| InChIKey | LPSIHYJPNXQGEZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide?
The IUPAC name of N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide (CID 20854671) is N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
What is the SMILES notation for N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide?
The canonical SMILES for N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide is CC1CCCC(C)N1CCCNC(=O)c1ccc(N2CCCC2=O)cc1.
What is the InChIKey of N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide?
The InChIKey is LPSIHYJPNXQGEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N3O2/c1-16-6-3-7-17(2)23(16)15-5-13-22-21(26)18-9-11-19(12-10-18)24-14-4-8-20(24)25/h9-12,16-17H,3-8,13-15H2,1-2H3,(H,22,26).
What are the key properties of N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide?
N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide has a molecular weight of 357.50 g/mol, XLogP of 3.20, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-4-(2-oxopyrrolidin-1-yl)benzamide is sourced from PubChem (CID 20854671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).