C19H22N2O5S — CID 20854771
ethyl 2-[4-oxo-6-(1-thiophen-2-ylethylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]acetate (PubChem CID 20854771) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is ethyl 2-[4-oxo-6-(1-thiophen-2-ylethylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]acetate.
| Compound Name | ethyl 2-[4-oxo-6-(1-thiophen-2-ylethylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]acetate |
|---|---|
| PubChem CID | 20854771 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | ethyl 2-[4-oxo-6-(1-thiophen-2-ylethylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]acetate |
| SMILES | CCOC(=O)CN1CC23C=CC(O2)C(C(=O)NC(C)c2cccs2)C3C1=O |
| InChI | InChI=1S/C19H22N2O5S/c1-3-25-14(22)9-21-10-19-7-6-12(26-19)15(16(19)18(21)24)17(23)20-11(2)13-5-4-8-27-13/h4-8,11-12,15-16H,3,9-10H2,1-2H3,(H,20,23) |
| InChIKey | ZZMHIEVKIFQRHH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|