About methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate
methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate (PubChem CID 20855102) has the molecular formula C16H14ClN3O2
and a molecular weight of 315.76 g/mol. Its IUPAC name is methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate |
| PubChem CID | 20855102 |
| Molecular Formula | C16H14ClN3O2 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(C)nc2c1c(C)nn2-c1ccccc1Cl |
| InChI | InChI=1S/C16H14ClN3O2/c1-9-8-11(16(21)22-3)14-10(2)19-20(15(14)18-9)13-7-5-4-6-12(13)17/h4-8H,1-3H3 |
| InChIKey | FVAZAGXSSKESSO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate?
The IUPAC name of methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate (CID 20855102) is methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate.
What is the SMILES notation for methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate?
The canonical SMILES for methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate is COC(=O)c1cc(C)nc2c1c(C)nn2-c1ccccc1Cl.
What is the InChIKey of methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate?
The InChIKey is FVAZAGXSSKESSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3O2/c1-9-8-11(16(21)22-3)14-10(2)19-20(15(14)18-9)13-7-5-4-6-12(13)17/h4-8H,1-3H3.
What are the key properties of methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate?
methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate has a molecular weight of 315.76 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2-chlorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate is sourced from PubChem (CID 20855102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).