C21H15N3O2S2 — CID 20855150
2,8-bis(thiophen-2-ylmethyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione (PubChem CID 20855150) has the molecular formula C21H15N3O2S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2,8-bis(thiophen-2-ylmethyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 2,8-bis(thiophen-2-ylmethyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 20855150 |
| Molecular Formula | C21H15N3O2S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2,8-bis(thiophen-2-ylmethyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
| SMILES | O=c1c2cc3c(=O)n(Cc4cccs4)ccc3nc2ccn1Cc1cccs1 |
| InChI | InChI=1S/C21H15N3O2S2/c25-20-16-11-17-19(6-8-24(21(17)26)13-15-4-2-10-28-15)22-18(16)5-7-23(20)12-14-3-1-9-27-14/h1-11H,12-13H2 |
| InChIKey | BAYKEFQGQCASGA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|