About 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide
2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 20855285) has the molecular formula C25H30N2O4
and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide.
Molecular Properties
| Compound Name | 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide |
| PubChem CID | 20855285 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cccc3c2C(=O)N(C2CCCCC2)C3)c(OC)c1 |
| InChI | InChI=1S/C25H30N2O4/c1-30-20-12-11-17(22(15-20)31-2)13-14-26-24(28)21-10-6-7-18-16-27(25(29)23(18)21)19-8-4-3-5-9-19/h6-7,10-12,15,19H,3-5,8-9,13-14,16H2,1-2H3,(H,26,28) |
| InChIKey | YJKXVEYXQYMQQS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide?
The IUPAC name of 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide (CID 20855285) is 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide.
What is the SMILES notation for 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide?
The canonical SMILES for 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide is COc1ccc(CCNC(=O)c2cccc3c2C(=O)N(C2CCCCC2)C3)c(OC)c1.
What is the InChIKey of 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide?
The InChIKey is YJKXVEYXQYMQQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2O4/c1-30-20-12-11-17(22(15-20)31-2)13-14-26-24(28)21-10-6-7-18-16-27(25(29)23(18)21)19-8-4-3-5-9-19/h6-7,10-12,15,19H,3-5,8-9,13-14,16H2,1-2H3,(H,26,28).
What are the key properties of 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide?
2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide has a molecular weight of 422.53 g/mol, XLogP of 3.96, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N-[2-(2,4-dimethoxyphenyl)ethyl]-3-oxo-1H-isoindole-4-carboxamide is sourced from PubChem (CID 20855285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).