C21H21N5O3 — CID 20855385
2-[5-(4-ethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 20855385) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[5-(4-ethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-(4-ethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 20855385 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[5-(4-ethylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | CCc1ccc(N2C(=O)C3N=NN(CC(=O)Nc4ccc(C)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-3-14-6-10-16(11-7-14)26-20(28)18-19(21(26)29)25(24-23-18)12-17(27)22-15-8-4-13(2)5-9-15/h4-11,18-19H,3,12H2,1-2H3,(H,22,27) |
| InChIKey | HDIOEOFCYZTHJD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|