C19H18N4O4 — CID 20855451
3-benzyl-5-(3,4-dimethoxyphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 20855451) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is 3-benzyl-5-(3,4-dimethoxyphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | 3-benzyl-5-(3,4-dimethoxyphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 20855451 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 3-benzyl-5-(3,4-dimethoxyphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | COc1ccc(N2C(=O)C3N=NN(Cc4ccccc4)C3C2=O)cc1OC |
| InChI | InChI=1S/C19H18N4O4/c1-26-14-9-8-13(10-15(14)27-2)23-18(24)16-17(19(23)25)22(21-20-16)11-12-6-4-3-5-7-12/h3-10,16-17H,11H2,1-2H3 |
| InChIKey | CZYQSSBWTGCVQB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|