About 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene
1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene (PubChem CID 20856) has the molecular formula C19H24O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene.
Molecular Properties
| Compound Name | 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene |
| PubChem CID | 20856 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24O2/c1-19(2,3)18(14-6-10-16(20-4)11-7-14)15-8-12-17(21-5)13-9-15/h6-13,18H,1-5H3 |
| InChIKey | ISCNHUDJLJIUKB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene?
The IUPAC name of 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene (CID 20856) is 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene.
What is the SMILES notation for 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene?
The canonical SMILES for 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene is COc1ccc(C(c2ccc(OC)cc2)C(C)(C)C)cc1.
What is the InChIKey of 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene?
The InChIKey is ISCNHUDJLJIUKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O2/c1-19(2,3)18(14-6-10-16(20-4)11-7-14)15-8-12-17(21-5)13-9-15/h6-13,18H,1-5H3.
What are the key properties of 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene?
1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene has a molecular weight of 284.40 g/mol, XLogP of 4.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-[1-(4-methoxyphenyl)-2,2-dimethylpropyl]benzene is sourced from PubChem (CID 20856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).