About [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate (PubChem CID 2085621) has the molecular formula C18H19NO5S
and a molecular weight of 361.42 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate |
| PubChem CID | 2085621 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)c2cc3c(s2)CCC3)c1 |
| InChI | InChI=1S/C18H19NO5S/c1-22-12-6-7-14(23-2)13(9-12)19-17(20)10-24-18(21)16-8-11-4-3-5-15(11)25-16/h6-9H,3-5,10H2,1-2H3,(H,19,20) |
| InChIKey | UFLBSPDMFHIDTP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate?
The IUPAC name of [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate (CID 2085621) is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate.
What is the SMILES notation for [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate?
The canonical SMILES for [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate is COc1ccc(OC)c(NC(=O)COC(=O)c2cc3c(s2)CCC3)c1.
What is the InChIKey of [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate?
The InChIKey is UFLBSPDMFHIDTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5S/c1-22-12-6-7-14(23-2)13(9-12)19-17(20)10-24-18(21)16-8-11-4-3-5-15(11)25-16/h6-9H,3-5,10H2,1-2H3,(H,19,20).
What are the key properties of [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate?
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate has a molecular weight of 361.42 g/mol, XLogP of 3.05, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethoxyanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate is sourced from PubChem (CID 2085621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).