About 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine
1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine (PubChem CID 20856403) has the molecular formula C10H17N3O2S
and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine |
| PubChem CID | 20856403 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cnc[nH]2)C1 |
| InChI | InChI=1S/C10H17N3O2S/c1-8-3-9(2)6-13(5-8)16(14,15)10-4-11-7-12-10/h4,7-9H,3,5-6H2,1-2H3,(H,11,12) |
| InChIKey | IRAMYANTUSCFAP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine?
The IUPAC name of 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine (CID 20856403) is 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine.
What is the SMILES notation for 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine?
The canonical SMILES for 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine is CC1CC(C)CN(S(=O)(=O)c2cnc[nH]2)C1.
What is the InChIKey of 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine?
The InChIKey is IRAMYANTUSCFAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2S/c1-8-3-9(2)6-13(5-8)16(14,15)10-4-11-7-12-10/h4,7-9H,3,5-6H2,1-2H3,(H,11,12).
What are the key properties of 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine?
1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine has a molecular weight of 243.33 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-imidazol-5-ylsulfonyl)-3,5-dimethylpiperidine is sourced from PubChem (CID 20856403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).