C21H25N5O3S2 — CID 20857000
N-methyl-N-[2-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 20857000) has the molecular formula C21H25N5O3S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is N-methyl-N-[2-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-methyl-N-[2-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 20857000 |
| Molecular Formula | C21H25N5O3S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-methyl-N-[2-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Cc1ccc(N2CCN(C(=O)CN(C)S(=O)(=O)c3cccc4nsnc34)CC2C)cc1 |
| InChI | InChI=1S/C21H25N5O3S2/c1-15-7-9-17(10-8-15)26-12-11-25(13-16(26)2)20(27)14-24(3)31(28,29)19-6-4-5-18-21(19)23-30-22-18/h4-10,16H,11-14H2,1-3H3 |
| InChIKey | JLNGEKCXVAVARI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|