C20H14Cl2FN3OS — CID 20858039
8-(2,6-dichlorophenyl)-3-(4-fluorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 20858039) has the molecular formula C20H14Cl2FN3OS and a molecular weight of 434.32 g/mol. Its IUPAC name is 8-(2,6-dichlorophenyl)-3-(4-fluorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | 8-(2,6-dichlorophenyl)-3-(4-fluorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 20858039 |
| Molecular Formula | C20H14Cl2FN3OS |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 8-(2,6-dichlorophenyl)-3-(4-fluorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | N#CC1=C2SCN(c3ccc(F)cc3)CN2C(=O)CC1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H14Cl2FN3OS/c21-16-2-1-3-17(22)19(16)14-8-18(27)26-10-25(11-28-20(26)15(14)9-24)13-6-4-12(23)5-7-13/h1-7,14H,8,10-11H2 |
| InChIKey | YKEPBSYDUTVZIY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |