C26H30ClN3OS — CID 20858307
2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-[3-(N-ethylanilino)propyl]acetamide (PubChem CID 20858307) has the molecular formula C26H30ClN3OS and a molecular weight of 468.07 g/mol. Its IUPAC name is 2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-[3-(N-ethylanilino)propyl]acetamide.
| Compound Name | 2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-[3-(N-ethylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 20858307 |
| Molecular Formula | C26H30ClN3OS |
| Molecular Weight | 468.07 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-[3-(N-ethylanilino)propyl]acetamide |
| SMILES | CCN(CCCNC(=O)CSc1c2c(nc3ccc(Cl)cc13)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C26H30ClN3OS/c1-2-30(20-9-4-3-5-10-20)16-8-15-28-25(31)18-32-26-21-11-6-7-12-23(21)29-24-14-13-19(27)17-22(24)26/h3-5,9-10,13-14,17H,2,6-8,11-12,15-16,18H2,1H3,(H,28,31) |
| InChIKey | AHTOWTIMFZLHOI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.07 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|