C13H12Cl2N2O3S2 — CID 2085853
2-(2,5-dichlorophenyl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 2085853) has the molecular formula C13H12Cl2N2O3S2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 2085853 |
| Molecular Formula | C13H12Cl2N2O3S2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C13H12Cl2N2O3S2/c14-8-1-2-9(15)10(5-8)21-6-11(18)16-3-4-17-12(19)7-22-13(17)20/h1-2,5H,3-4,6-7H2,(H,16,18) |
| InChIKey | TYQBLOZZKBRERB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|