C14H16N2O4S — CID 20858698
4-[(4-propan-2-ylphenyl)sulfamoyl]furan-2-carboxamide (PubChem CID 20858698) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-[(4-propan-2-ylphenyl)sulfamoyl]furan-2-carboxamide.
| Compound Name | 4-[(4-propan-2-ylphenyl)sulfamoyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20858698 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-[(4-propan-2-ylphenyl)sulfamoyl]furan-2-carboxamide |
| SMILES | CC(C)c1ccc(NS(=O)(=O)c2coc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C14H16N2O4S/c1-9(2)10-3-5-11(6-4-10)16-21(18,19)12-7-13(14(15)17)20-8-12/h3-9,16H,1-2H3,(H2,15,17) |
| InChIKey | YUXQJRYRPWYQTO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |