C23H29N3O4S — CID 20859102
N-[2-(cyclohexen-1-yl)ethyl]-1-methyl-4-oxo-6-pyrrolidin-1-ylsulfonylquinoline-3-carboxamide (PubChem CID 20859102) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-methyl-4-oxo-6-pyrrolidin-1-ylsulfonylquinoline-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-methyl-4-oxo-6-pyrrolidin-1-ylsulfonylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 20859102 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-methyl-4-oxo-6-pyrrolidin-1-ylsulfonylquinoline-3-carboxamide |
| SMILES | Cn1cc(C(=O)NCCC2=CCCCC2)c(=O)c2cc(S(=O)(=O)N3CCCC3)ccc21 |
| InChI | InChI=1S/C23H29N3O4S/c1-25-16-20(23(28)24-12-11-17-7-3-2-4-8-17)22(27)19-15-18(9-10-21(19)25)31(29,30)26-13-5-6-14-26/h7,9-10,15-16H,2-6,8,11-14H2,1H3,(H,24,28) |
| InChIKey | FFFZEOWHBIPTRO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|