About 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide
2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide (PubChem CID 2086052) has the molecular formula C19H20FN3O4S
and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide.
Molecular Properties
| Compound Name | 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide |
| PubChem CID | 2086052 |
| Molecular Formula | C19H20FN3O4S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1F)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H20FN3O4S/c20-17-7-3-2-6-16(17)19(25)22-21-18(24)14-8-10-15(11-9-14)28(26,27)23-12-4-1-5-13-23/h2-3,6-11H,1,4-5,12-13H2,(H,21,24)(H,22,25) |
| InChIKey | KCPDQAWHULLNPK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide?
The IUPAC name of 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide (CID 2086052) is 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide.
What is the SMILES notation for 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide?
The canonical SMILES for 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide is O=C(NNC(=O)c1ccccc1F)c1ccc(S(=O)(=O)N2CCCCC2)cc1.
What is the InChIKey of 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide?
The InChIKey is KCPDQAWHULLNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O4S/c20-17-7-3-2-6-16(17)19(25)22-21-18(24)14-8-10-15(11-9-14)28(26,27)23-12-4-1-5-13-23/h2-3,6-11H,1,4-5,12-13H2,(H,21,24)(H,22,25).
What are the key properties of 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide?
2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide has a molecular weight of 405.45 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-(4-piperidin-1-ylsulfonylbenzoyl)benzohydrazide is sourced from PubChem (CID 2086052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).