C31H34FN3O3S — CID 20860958
N-[3-(2-ethylpiperidin-1-yl)propyl]-5-[(4-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 20860958) has the molecular formula C31H34FN3O3S and a molecular weight of 547.70 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-5-[(4-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-5-[(4-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 20860958 |
| Molecular Formula | C31H34FN3O3S |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-5-[(4-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCC1CCCCN1CCCNC(=O)c1ccc2c(c1)N(Cc1ccc(F)cc1)C(=O)c1ccccc1S2=O |
| InChI | InChI=1S/C31H34FN3O3S/c1-2-25-8-5-6-18-34(25)19-7-17-33-30(36)23-13-16-29-27(20-23)35(21-22-11-14-24(32)15-12-22)31(37)26-9-3-4-10-28(26)39(29)38/h3-4,9-16,20,25H,2,5-8,17-19,21H2,1H3,(H,33,36) |
| InChIKey | SKRXFKGFKFOOKW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|