C25H23ClN2O4S — CID 20861144
N-butyl-5-[(4-chlorophenyl)methyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 20861144) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is N-butyl-5-[(4-chlorophenyl)methyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-butyl-5-[(4-chlorophenyl)methyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 20861144 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-butyl-5-[(4-chlorophenyl)methyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)N(Cc1ccc(Cl)cc1)C(=O)c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C25H23ClN2O4S/c1-2-3-14-27-24(29)18-10-13-23-21(15-18)28(16-17-8-11-19(26)12-9-17)25(30)20-6-4-5-7-22(20)33(23,31)32/h4-13,15H,2-3,14,16H2,1H3,(H,27,29) |
| InChIKey | BINYZZOKVFIZRD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|