C19H16Cl2N2O3S — CID 20861862
N-(5-chloro-2-methoxyphenyl)-2-(6-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanylacetamide (PubChem CID 20861862) has the molecular formula C19H16Cl2N2O3S and a molecular weight of 423.32 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(6-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanylacetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(6-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 20861862 |
| Molecular Formula | C19H16Cl2N2O3S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(6-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanylacetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1cc(=O)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H16Cl2N2O3S/c1-23-15-5-3-11(20)7-13(15)17(9-19(23)25)27-10-18(24)22-14-8-12(21)4-6-16(14)26-2/h3-9H,10H2,1-2H3,(H,22,24) |
| InChIKey | RAMCHSVKYJZHFC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |