C16H12ClF2N5O — CID 20862542
5-amino-N-(3-chloro-4-fluorophenyl)-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide (PubChem CID 20862542) has the molecular formula C16H12ClF2N5O and a molecular weight of 363.76 g/mol. Its IUPAC name is 5-amino-N-(3-chloro-4-fluorophenyl)-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide.
| Compound Name | 5-amino-N-(3-chloro-4-fluorophenyl)-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 20862542 |
| Molecular Formula | C16H12ClF2N5O |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 5-amino-N-(3-chloro-4-fluorophenyl)-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide |
| SMILES | Nc1c(C(=O)Nc2ccc(F)c(Cl)c2)nnn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H12ClF2N5O/c17-12-7-11(5-6-13(12)19)21-16(25)14-15(20)24(23-22-14)8-9-1-3-10(18)4-2-9/h1-7H,8,20H2,(H,21,25) |
| InChIKey | NCGWOUIRFJPDSS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |