About [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate
[2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate (PubChem CID 2086256) has the molecular formula C16H19N3O4S2
and a molecular weight of 381.48 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate.
Molecular Properties
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
| PubChem CID | 2086256 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
| SMILES | CCNC(=O)NC(=O)COC(=O)CCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H19N3O4S2/c1-2-17-15(22)19-13(20)10-23-14(21)8-5-9-24-16-18-11-6-3-4-7-12(11)25-16/h3-4,6-7H,2,5,8-10H2,1H3,(H2,17,19,20,22) |
| InChIKey | GASBQCVAGJLIAS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate?
The IUPAC name of [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate (CID 2086256) is [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate.
What is the SMILES notation for [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate?
The canonical SMILES for [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate is CCNC(=O)NC(=O)COC(=O)CCCSc1nc2ccccc2s1.
What is the InChIKey of [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate?
The InChIKey is GASBQCVAGJLIAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4S2/c1-2-17-15(22)19-13(20)10-23-14(21)8-5-9-24-16-18-11-6-3-4-7-12(11)25-16/h3-4,6-7H,2,5,8-10H2,1H3,(H2,17,19,20,22).
What are the key properties of [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate?
[2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate has a molecular weight of 381.48 g/mol, XLogP of 2.56, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(ethylcarbamoylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate is sourced from PubChem (CID 2086256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).