C18H18BrN5O2 — CID 20862674
5-amino-1-[(5-bromo-2-methoxyphenyl)methyl]-N-(3-methylphenyl)triazole-4-carboxamide (PubChem CID 20862674) has the molecular formula C18H18BrN5O2 and a molecular weight of 416.28 g/mol. Its IUPAC name is 5-amino-1-[(5-bromo-2-methoxyphenyl)methyl]-N-(3-methylphenyl)triazole-4-carboxamide.
| Compound Name | 5-amino-1-[(5-bromo-2-methoxyphenyl)methyl]-N-(3-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 20862674 |
| Molecular Formula | C18H18BrN5O2 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 5-amino-1-[(5-bromo-2-methoxyphenyl)methyl]-N-(3-methylphenyl)triazole-4-carboxamide |
| SMILES | COc1ccc(Br)cc1Cn1nnc(C(=O)Nc2cccc(C)c2)c1N |
| InChI | InChI=1S/C18H18BrN5O2/c1-11-4-3-5-14(8-11)21-18(25)16-17(20)24(23-22-16)10-12-9-13(19)6-7-15(12)26-2/h3-9H,10,20H2,1-2H3,(H,21,25) |
| InChIKey | BZPOCWKPYPMHCN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |