About N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine
N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 20864) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 20864 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CCc1cccc(CC)c1NC1=NCCN1 |
| InChI | InChI=1S/C13H19N3/c1-3-10-6-5-7-11(4-2)12(10)16-13-14-8-9-15-13/h5-7H,3-4,8-9H2,1-2H3,(H2,14,15,16) |
| InChIKey | IALHTUPVRAQZFI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine (CID 20864) is N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine is CCc1cccc(CC)c1NC1=NCCN1.
What is the InChIKey of N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is IALHTUPVRAQZFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-3-10-6-5-7-11(4-2)12(10)16-13-14-8-9-15-13/h5-7H,3-4,8-9H2,1-2H3,(H2,14,15,16).
What are the key properties of N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine?
N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 217.32 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 20864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).