C23H25F3N4O4 — CID 20864082
3-(1,3,5,7-tetramethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide (PubChem CID 20864082) has the molecular formula C23H25F3N4O4 and a molecular weight of 478.47 g/mol. Its IUPAC name is 3-(1,3,5,7-tetramethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide.
| Compound Name | 3-(1,3,5,7-tetramethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 20864082 |
| Molecular Formula | C23H25F3N4O4 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3-(1,3,5,7-tetramethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide |
| SMILES | Cc1nc2c(c(C)c1CCC(=O)NCCOc1cccc(C(F)(F)F)c1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C23H25F3N4O4/c1-13-17(14(2)28-20-19(13)21(32)30(4)22(33)29(20)3)8-9-18(31)27-10-11-34-16-7-5-6-15(12-16)23(24,25)26/h5-7,12H,8-11H2,1-4H3,(H,27,31) |
| InChIKey | ICZMFBFSWIYCDG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|