About N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide
N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide (PubChem CID 20864732) has the molecular formula C11H7F2N3O4
and a molecular weight of 283.19 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide |
| PubChem CID | 20864732 |
| Molecular Formula | C11H7F2N3O4 |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide |
| SMILES | Cc1onc(C(=O)Nc2ccc(F)cc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7F2N3O4/c1-5-10(16(18)19)9(15-20-5)11(17)14-8-3-2-6(12)4-7(8)13/h2-4H,1H3,(H,14,17) |
| InChIKey | QPENBBGGNZGVFM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide (CID 20864732) is N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide is Cc1onc(C(=O)Nc2ccc(F)cc2F)c1[N+](=O)[O-].
What is the InChIKey of N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide?
The InChIKey is QPENBBGGNZGVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2N3O4/c1-5-10(16(18)19)9(15-20-5)11(17)14-8-3-2-6(12)4-7(8)13/h2-4H,1H3,(H,14,17).
What are the key properties of N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide?
N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide has a molecular weight of 283.19 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)-5-methyl-4-nitro-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 20864732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).