About N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide
N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide (PubChem CID 20864753) has the molecular formula C9H13N3O4
and a molecular weight of 227.22 g/mol. Its IUPAC name is N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide |
| PubChem CID | 20864753 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1noc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N3O4/c1-4-11(5-2)9(13)7-8(12(14)15)6(3)16-10-7/h4-5H2,1-3H3 |
| InChIKey | VZLAEADMFINUMU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide?
The IUPAC name of N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide (CID 20864753) is N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide?
The canonical SMILES for N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide is CCN(CC)C(=O)c1noc(C)c1[N+](=O)[O-].
What is the InChIKey of N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide?
The InChIKey is VZLAEADMFINUMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c1-4-11(5-2)9(13)7-8(12(14)15)6(3)16-10-7/h4-5H2,1-3H3.
What are the key properties of N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide?
N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide has a molecular weight of 227.22 g/mol, XLogP of 1.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-5-methyl-4-nitro-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 20864753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).