C26H26N2O2S — CID 20865301
2-(4-benzylpiperidine-1-carbonyl)-5-ethylthieno[3,2-c]quinolin-4-one (PubChem CID 20865301) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-(4-benzylpiperidine-1-carbonyl)-5-ethylthieno[3,2-c]quinolin-4-one.
| Compound Name | 2-(4-benzylpiperidine-1-carbonyl)-5-ethylthieno[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 20865301 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-(4-benzylpiperidine-1-carbonyl)-5-ethylthieno[3,2-c]quinolin-4-one |
| SMILES | CCn1c(=O)c2cc(C(=O)N3CCC(Cc4ccccc4)CC3)sc2c2ccccc21 |
| InChI | InChI=1S/C26H26N2O2S/c1-2-28-22-11-7-6-10-20(22)24-21(25(28)29)17-23(31-24)26(30)27-14-12-19(13-15-27)16-18-8-4-3-5-9-18/h3-11,17,19H,2,12-16H2,1H3 |
| InChIKey | YVMZIWPOSDGOSO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |