About 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide
8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide (PubChem CID 20865592) has the molecular formula C16H10N2O3S2
and a molecular weight of 342.40 g/mol. Its IUPAC name is 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide.
Molecular Properties
| Compound Name | 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide |
| PubChem CID | 20865592 |
| Molecular Formula | C16H10N2O3S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1ccc2oc(=O)c3cc(C(=O)Nc4nccs4)sc3c2c1 |
| InChI | InChI=1S/C16H10N2O3S2/c1-8-2-3-11-9(6-8)13-10(15(20)21-11)7-12(23-13)14(19)18-16-17-4-5-22-16/h2-7H,1H3,(H,17,18,19) |
| InChIKey | PFAXBJUBNUHEHY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide?
The IUPAC name of 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide (CID 20865592) is 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide.
What is the SMILES notation for 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide?
The canonical SMILES for 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide is Cc1ccc2oc(=O)c3cc(C(=O)Nc4nccs4)sc3c2c1.
What is the InChIKey of 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide?
The InChIKey is PFAXBJUBNUHEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O3S2/c1-8-2-3-11-9(6-8)13-10(15(20)21-11)7-12(23-13)14(19)18-16-17-4-5-22-16/h2-7H,1H3,(H,17,18,19).
What are the key properties of 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide?
8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide has a molecular weight of 342.40 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4-oxo-N-(1,3-thiazol-2-yl)thieno[3,2-c]chromene-2-carboxamide is sourced from PubChem (CID 20865592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).