C26H22N2O6S — CID 20865624
N-[3-(3,4-diethoxyphenyl)-1,2-oxazol-5-yl]-8-methyl-4-oxothieno[3,2-c]chromene-2-carboxamide (PubChem CID 20865624) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is N-[3-(3,4-diethoxyphenyl)-1,2-oxazol-5-yl]-8-methyl-4-oxothieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-[3-(3,4-diethoxyphenyl)-1,2-oxazol-5-yl]-8-methyl-4-oxothieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 20865624 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | N-[3-(3,4-diethoxyphenyl)-1,2-oxazol-5-yl]-8-methyl-4-oxothieno[3,2-c]chromene-2-carboxamide |
| SMILES | CCOc1ccc(-c2cc(NC(=O)c3cc4c(=O)oc5ccc(C)cc5c4s3)on2)cc1OCC |
| InChI | InChI=1S/C26H22N2O6S/c1-4-31-20-9-7-15(11-21(20)32-5-2)18-13-23(34-28-18)27-25(29)22-12-17-24(35-22)16-10-14(3)6-8-19(16)33-26(17)30/h6-13H,4-5H2,1-3H3,(H,27,29) |
| InChIKey | SCYAXHWHJRHOBE-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|