C24H22N2O3 — CID 20866712
ethyl 2-[(2-benzyl-3-oxo-1H-isoindol-1-yl)amino]benzoate (PubChem CID 20866712) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl 2-[(2-benzyl-3-oxo-1H-isoindol-1-yl)amino]benzoate.
| Compound Name | ethyl 2-[(2-benzyl-3-oxo-1H-isoindol-1-yl)amino]benzoate |
|---|---|
| PubChem CID | 20866712 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | ethyl 2-[(2-benzyl-3-oxo-1H-isoindol-1-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC1c2ccccc2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H22N2O3/c1-2-29-24(28)20-14-8-9-15-21(20)25-22-18-12-6-7-13-19(18)23(27)26(22)16-17-10-4-3-5-11-17/h3-15,22,25H,2,16H2,1H3 |
| InChIKey | JNCYPVLECGAOBQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |