About [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate
[3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate (PubChem CID 20866816) has the molecular formula C19H13F2N3O3
and a molecular weight of 369.33 g/mol. Its IUPAC name is [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate.
Molecular Properties
| Compound Name | [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate |
| PubChem CID | 20866816 |
| Molecular Formula | C19H13F2N3O3 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate |
| SMILES | O=C(OCc1nccnc1C(=O)Nc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C19H13F2N3O3/c20-13-6-7-15(14(21)10-13)24-18(25)17-16(22-8-9-23-17)11-27-19(26)12-4-2-1-3-5-12/h1-10H,11H2,(H,24,25) |
| InChIKey | YYASRPKVPIASCV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate?
The IUPAC name of [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate (CID 20866816) is [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate.
What is the SMILES notation for [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate?
The canonical SMILES for [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate is O=C(OCc1nccnc1C(=O)Nc1ccc(F)cc1F)c1ccccc1.
What is the InChIKey of [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate?
The InChIKey is YYASRPKVPIASCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2N3O3/c20-13-6-7-15(14(21)10-13)24-18(25)17-16(22-8-9-23-17)11-27-19(26)12-4-2-1-3-5-12/h1-10H,11H2,(H,24,25).
What are the key properties of [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate?
[3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate has a molecular weight of 369.33 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,4-difluorophenyl)carbamoyl]pyrazin-2-yl]methyl benzoate is sourced from PubChem (CID 20866816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).