About 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide
3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide (PubChem CID 20867282) has the molecular formula C20H24N4O
and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide.
Molecular Properties
| Compound Name | 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide |
| PubChem CID | 20867282 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide |
| SMILES | CCCCNC(=O)CCc1nc2cccnc2n1Cc1ccccc1 |
| InChI | InChI=1S/C20H24N4O/c1-2-3-13-21-19(25)12-11-18-23-17-10-7-14-22-20(17)24(18)15-16-8-5-4-6-9-16/h4-10,14H,2-3,11-13,15H2,1H3,(H,21,25) |
| InChIKey | BGELRWNDCNKDAV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide?
The IUPAC name of 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide (CID 20867282) is 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide.
What is the SMILES notation for 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide?
The canonical SMILES for 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide is CCCCNC(=O)CCc1nc2cccnc2n1Cc1ccccc1.
What is the InChIKey of 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide?
The InChIKey is BGELRWNDCNKDAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O/c1-2-3-13-21-19(25)12-11-18-23-17-10-7-14-22-20(17)24(18)15-16-8-5-4-6-9-16/h4-10,14H,2-3,11-13,15H2,1H3,(H,21,25).
What are the key properties of 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide?
3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide has a molecular weight of 336.44 g/mol, XLogP of 3.33, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-butylpropanamide is sourced from PubChem (CID 20867282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).