About ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate
ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate (PubChem CID 20867532) has the molecular formula C24H22N4O3
and a molecular weight of 414.47 g/mol. Its IUPAC name is ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate |
| PubChem CID | 20867532 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCc2nc3cccnc3n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-2-31-24(30)17-10-12-18(13-11-17)26-22(29)15-14-21-27-20-9-6-16-25-23(20)28(21)19-7-4-3-5-8-19/h3-13,16H,2,14-15H2,1H3,(H,26,29) |
| InChIKey | LREZOYQNHGLEMJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate?
The IUPAC name of ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate (CID 20867532) is ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate.
What is the SMILES notation for ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate?
The canonical SMILES for ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate is CCOC(=O)c1ccc(NC(=O)CCc2nc3cccnc3n2-c2ccccc2)cc1.
What is the InChIKey of ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate?
The InChIKey is LREZOYQNHGLEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O3/c1-2-31-24(30)17-10-12-18(13-11-17)26-22(29)15-14-21-27-20-9-6-16-25-23(20)28(21)19-7-4-3-5-8-19/h3-13,16H,2,14-15H2,1H3,(H,26,29).
What are the key properties of ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate?
ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate has a molecular weight of 414.47 g/mol, XLogP of 4.17, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-(3-phenylimidazo[4,5-b]pyridin-2-yl)propanoylamino]benzoate is sourced from PubChem (CID 20867532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).