C19H23ClN2OS — CID 20867689
N-butyl-2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]acetamide (PubChem CID 20867689) has the molecular formula C19H23ClN2OS and a molecular weight of 362.93 g/mol. Its IUPAC name is N-butyl-2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]acetamide.
| Compound Name | N-butyl-2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 20867689 |
| Molecular Formula | C19H23ClN2OS |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-butyl-2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]acetamide |
| SMILES | CCCCNC(=O)CSc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C19H23ClN2OS/c1-2-3-10-21-18(23)12-24-19-14-6-4-5-7-16(14)22-17-11-13(20)8-9-15(17)19/h8-9,11H,2-7,10,12H2,1H3,(H,21,23) |
| InChIKey | VVBJYRAUXCTLNE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|