C18H15ClN2O4 — CID 2086803
[2-[(3R)-5-(4-chlorophenyl)-3-(furan-2-yl)-1,3-dihydropyrazol-2-yl]-2-oxoethyl] prop-2-enoate (PubChem CID 2086803) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is [2-[(3R)-5-(4-chlorophenyl)-3-(furan-2-yl)-1,3-dihydropyrazol-2-yl]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[(3R)-5-(4-chlorophenyl)-3-(furan-2-yl)-1,3-dihydropyrazol-2-yl]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 2086803 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [2-[(3R)-5-(4-chlorophenyl)-3-(furan-2-yl)-1,3-dihydropyrazol-2-yl]-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)N1NC(c2ccc(Cl)cc2)=C[C@@H]1c1ccco1 |
| InChI | InChI=1S/C18H15ClN2O4/c1-2-18(23)25-11-17(22)21-15(16-4-3-9-24-16)10-14(20-21)12-5-7-13(19)8-6-12/h2-10,15,20H,1,11H2/t15-/m1/s1 |
| InChIKey | MYPKEQHZHZKUQR-OAHLLOKOSA-N |
| XLogP | 3.09 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|