C39H75N9O3 — CID 20870638
2-[4-[[4,6-bis[[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]-methylamino]-1,3,5-triazin-2-yl]-methylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol (PubChem CID 20870638) has the molecular formula C39H75N9O3 and a molecular weight of 718.09 g/mol. Its IUPAC name is 2-[4-[[4,6-bis[[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]-methylamino]-1,3,5-triazin-2-yl]-methylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol.
| Compound Name | 2-[4-[[4,6-bis[[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]-methylamino]-1,3,5-triazin-2-yl]-methylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 20870638 |
| Molecular Formula | C39H75N9O3 |
| Molecular Weight | 718.09 g/mol |
| Exact Mass | 717.60 |
| IUPAC Name | 2-[4-[[4,6-bis[[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]-methylamino]-1,3,5-triazin-2-yl]-methylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
| SMILES | CN(c1nc(N(C)C2CC(C)(C)N(CCO)C(C)(C)C2)nc(N(C)C2CC(C)(C)N(CCO)C(C)(C)C2)n1)C1CC(C)(C)N(CCO)C(C)(C)C1 |
| InChI | InChI=1S/C39H75N9O3/c1-34(2)22-28(23-35(3,4)46(34)16-19-49)43(13)31-40-32(44(14)29-24-36(5,6)47(17-20-50)37(7,8)25-29)42-33(41-31)45(15)30-26-38(9,10)48(18-21-51)39(11,12)27-30/h28-30,49-51H,16-27H2,1-15H3 |
| InChIKey | DCZBKCHSNQOJGS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.09 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |