About dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol)
dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol) (PubChem CID 20870807) has the molecular formula C44H42Cl2N2O2Zr
and a molecular weight of 792.96 g/mol. Its IUPAC name is dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol).
Molecular Properties
| Compound Name | dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol) |
| PubChem CID | 20870807 |
| Molecular Formula | C44H42Cl2N2O2Zr |
| Molecular Weight | 792.96 g/mol |
| Exact Mass | 790.17 |
| IUPAC Name | dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol) |
| SMILES | C/N=C(/CC(O)(c1ccccc1)c1ccccc1)c1ccccc1.C/N=C(/CC(O)(c1ccccc1)c1ccccc1)c1ccccc1.Cl[Zr]Cl |
| InChI | InChI=1S/2C22H21NO.2ClH.Zr/c2*1-23-21(18-11-5-2-6-12-18)17-22(24,19-13-7-3-8-14-19)20-15-9-4-10-16-20;;;/h2*2-16,24H,17H2,1H3;2*1H;/q;;;;+2/p-2/b2*23-21-;;; |
| InChIKey | ZZPVBROTIAFPPQ-GYKOIODYSA-L |
| XLogP | 10.24 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 792.96 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol)?
The IUPAC name of dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol) (CID 20870807) is dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol).
What is the SMILES notation for dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol)?
The canonical SMILES for dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol) is C/N=C(/CC(O)(c1ccccc1)c1ccccc1)c1ccccc1.C/N=C(/CC(O)(c1ccccc1)c1ccccc1)c1ccccc1.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol)?
The InChIKey is ZZPVBROTIAFPPQ-GYKOIODYSA-L. The full InChI is InChI=1S/2C22H21NO.2ClH.Zr/c2*1-23-21(18-11-5-2-6-12-18)17-22(24,19-13-7-3-8-14-19)20-15-9-4-10-16-20;;;/h2*2-16,24H,17H2,1H3;2*1H;/q;;;;+2/p-2/b2*23-21-;;;.
What are the key properties of dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol)?
dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol) has a molecular weight of 792.96 g/mol, XLogP of 10.24, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;bis(3-methylimino-1,1,3-triphenylpropan-1-ol) is sourced from PubChem (CID 20870807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).